methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate

C22H20O7 — CID 56955596

IUPACmethyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate
SMILESCOC(=O)c1c(C(=O)c2ccc(OC)c(OC)c2OC)coc1-c1ccccc1
InChIInChI=1S/C22H20O7/c1-25-16-11-10-14(20(26-2)21(16)27-3)18(23)15-12-29-19(17(15)22(24)28-4)13-8-6-5-7-9-13/h5-12H,1-4H3
InChIKeyJWUCPSBWYNKBIK-UHFFFAOYSA-N
MW396.40 g/mol
LogP3.99
Rot. Bonds7

About methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate

methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate (PubChem CID 56955596) has the molecular formula C22H20O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate.

Molecular Properties

Compound Namemethyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate
PubChem CID56955596
Molecular FormulaC22H20O7
Molecular Weight396.40 g/mol
Exact Mass396.12
IUPAC Namemethyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate
SMILESCOC(=O)c1c(C(=O)c2ccc(OC)c(OC)c2OC)coc1-c1ccccc1
InChIInChI=1S/C22H20O7/c1-25-16-11-10-14(20(26-2)21(16)27-3)18(23)15-12-29-19(17(15)22(24)28-4)13-8-6-5-7-9-13/h5-12H,1-4H3
InChIKeyJWUCPSBWYNKBIK-UHFFFAOYSA-N
XLogP3.99
TPSA84.20 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500396.40
LogP ≤ 53.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate?
The IUPAC name of methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate (CID 56955596) is methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate.
What is the SMILES notation for methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate?
The canonical SMILES for methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate is COC(=O)c1c(C(=O)c2ccc(OC)c(OC)c2OC)coc1-c1ccccc1.
What is the InChIKey of methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate?
The InChIKey is JWUCPSBWYNKBIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O7/c1-25-16-11-10-14(20(26-2)21(16)27-3)18(23)15-12-29-19(17(15)22(24)28-4)13-8-6-5-7-9-13/h5-12H,1-4H3.
What are the key properties of methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate?
methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate has a molecular weight of 396.40 g/mol, XLogP of 3.99, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate is sourced from PubChem (CID 56955596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).