C22H20O7 — CID 56955596
methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate (PubChem CID 56955596) has the molecular formula C22H20O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate.
| Compound Name | methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 56955596 |
| Molecular Formula | C22H20O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | methyl 2-phenyl-4-(2,3,4-trimethoxybenzoyl)furan-3-carboxylate |
| SMILES | COC(=O)c1c(C(=O)c2ccc(OC)c(OC)c2OC)coc1-c1ccccc1 |
| InChI | InChI=1S/C22H20O7/c1-25-16-11-10-14(20(26-2)21(16)27-3)18(23)15-12-29-19(17(15)22(24)28-4)13-8-6-5-7-9-13/h5-12H,1-4H3 |
| InChIKey | JWUCPSBWYNKBIK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |