C19H22O7 — CID 19812692
[3,4-dimethoxy-2-(methoxymethoxy)phenyl]-[2-(methoxymethoxy)phenyl]methanone (PubChem CID 19812692) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is [3,4-dimethoxy-2-(methoxymethoxy)phenyl]-[2-(methoxymethoxy)phenyl]methanone.
| Compound Name | [3,4-dimethoxy-2-(methoxymethoxy)phenyl]-[2-(methoxymethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 19812692 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [3,4-dimethoxy-2-(methoxymethoxy)phenyl]-[2-(methoxymethoxy)phenyl]methanone |
| SMILES | COCOc1ccccc1C(=O)c1ccc(OC)c(OC)c1OCOC |
| InChI | InChI=1S/C19H22O7/c1-21-11-25-15-8-6-5-7-13(15)17(20)14-9-10-16(23-3)19(24-4)18(14)26-12-22-2/h5-10H,11-12H2,1-4H3 |
| InChIKey | MCNWZKUNWJGDBR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|