C15H16O4S — CID 102839751
(2-methylthiophen-3-yl)-(2,3,4-trimethoxyphenyl)methanone (PubChem CID 102839751) has the molecular formula C15H16O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is (2-methylthiophen-3-yl)-(2,3,4-trimethoxyphenyl)methanone.
| Compound Name | (2-methylthiophen-3-yl)-(2,3,4-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 102839751 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (2-methylthiophen-3-yl)-(2,3,4-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccsc2C)c(OC)c1OC |
| InChI | InChI=1S/C15H16O4S/c1-9-10(7-8-20-9)13(16)11-5-6-12(17-2)15(19-4)14(11)18-3/h5-8H,1-4H3 |
| InChIKey | RHOAOOWEOGGBTM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |