C12H13F3O4 — CID 43588937
3,3,3-trifluoro-1-(2,3,4-trimethoxyphenyl)propan-1-one (PubChem CID 43588937) has the molecular formula C12H13F3O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-(2,3,4-trimethoxyphenyl)propan-1-one.
| Compound Name | 3,3,3-trifluoro-1-(2,3,4-trimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 43588937 |
| Molecular Formula | C12H13F3O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3,3,3-trifluoro-1-(2,3,4-trimethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)CC(F)(F)F)c(OC)c1OC |
| InChI | InChI=1S/C12H13F3O4/c1-17-9-5-4-7(8(16)6-12(13,14)15)10(18-2)11(9)19-3/h4-5H,6H2,1-3H3 |
| InChIKey | BNSXCIWWWIADIC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |