C13H16O7 — CID 61327591
2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid (PubChem CID 61327591) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid.
| Compound Name | 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 61327591 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid |
| SMILES | COc1ccc(C(=O)COCC(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C13H16O7/c1-17-10-5-4-8(12(18-2)13(10)19-3)9(14)6-20-7-11(15)16/h4-5H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | NYFRBUQAIKHYPT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |