2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid

C13H16O7 — CID 61327591

IUPAC2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid
SMILESCOc1ccc(C(=O)COCC(=O)O)c(OC)c1OC
InChIInChI=1S/C13H16O7/c1-17-10-5-4-8(12(18-2)13(10)19-3)9(14)6-20-7-11(15)16/h4-5H,6-7H2,1-3H3,(H,15,16)
InChIKeyNYFRBUQAIKHYPT-UHFFFAOYSA-N
MW284.26 g/mol
LogP1.00
Rot. Bonds8

About 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid

2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid (PubChem CID 61327591) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid.

Molecular Properties

Compound Name2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid
PubChem CID61327591
Molecular FormulaC13H16O7
Molecular Weight284.26 g/mol
Exact Mass284.09
IUPAC Name2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid
SMILESCOc1ccc(C(=O)COCC(=O)O)c(OC)c1OC
InChIInChI=1S/C13H16O7/c1-17-10-5-4-8(12(18-2)13(10)19-3)9(14)6-20-7-11(15)16/h4-5H,6-7H2,1-3H3,(H,15,16)
InChIKeyNYFRBUQAIKHYPT-UHFFFAOYSA-N
XLogP1.00
TPSA91.29 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.26
LogP ≤ 51.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid?
The IUPAC name of 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid (CID 61327591) is 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid.
What is the SMILES notation for 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid?
The canonical SMILES for 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid is COc1ccc(C(=O)COCC(=O)O)c(OC)c1OC.
What is the InChIKey of 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid?
The InChIKey is NYFRBUQAIKHYPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O7/c1-17-10-5-4-8(12(18-2)13(10)19-3)9(14)6-20-7-11(15)16/h4-5H,6-7H2,1-3H3,(H,15,16).
What are the key properties of 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid?
2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid has a molecular weight of 284.26 g/mol, XLogP of 1.00, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-oxo-2-(2,3,4-trimethoxyphenyl)ethoxy]acetic acid is sourced from PubChem (CID 61327591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).