C13H14O5 — CID 23050465
4-hydroxy-1-(2,3,4-trimethoxyphenyl)but-2-yn-1-one (PubChem CID 23050465) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 4-hydroxy-1-(2,3,4-trimethoxyphenyl)but-2-yn-1-one.
| Compound Name | 4-hydroxy-1-(2,3,4-trimethoxyphenyl)but-2-yn-1-one |
|---|---|
| PubChem CID | 23050465 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-hydroxy-1-(2,3,4-trimethoxyphenyl)but-2-yn-1-one |
| SMILES | COc1ccc(C(=O)C#CCO)c(OC)c1OC |
| InChI | InChI=1S/C13H14O5/c1-16-11-7-6-9(10(15)5-4-8-14)12(17-2)13(11)18-3/h6-7,14H,8H2,1-3H3 |
| InChIKey | ZKASIXNQCZVAAX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|