C13H15F3O5 — CID 103206613
2-(2,2,2-trifluoroethoxy)-1-(2,3,4-trimethoxyphenyl)ethanone (PubChem CID 103206613) has the molecular formula C13H15F3O5 and a molecular weight of 308.25 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)-1-(2,3,4-trimethoxyphenyl)ethanone.
| Compound Name | 2-(2,2,2-trifluoroethoxy)-1-(2,3,4-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 103206613 |
| Molecular Formula | C13H15F3O5 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)-1-(2,3,4-trimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)COCC(F)(F)F)c(OC)c1OC |
| InChI | InChI=1S/C13H15F3O5/c1-18-10-5-4-8(11(19-2)12(10)20-3)9(17)6-21-7-13(14,15)16/h4-5H,6-7H2,1-3H3 |
| InChIKey | LSKDCTQVWZURKH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |