C14H10ClF3O2 — CID 103206734
1-(4-chloronaphthalen-1-yl)-2-(2,2,2-trifluoroethoxy)ethanone (PubChem CID 103206734) has the molecular formula C14H10ClF3O2 and a molecular weight of 302.68 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)-2-(2,2,2-trifluoroethoxy)ethanone.
| Compound Name | 1-(4-chloronaphthalen-1-yl)-2-(2,2,2-trifluoroethoxy)ethanone |
|---|---|
| PubChem CID | 103206734 |
| Molecular Formula | C14H10ClF3O2 |
| Molecular Weight | 302.68 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)-2-(2,2,2-trifluoroethoxy)ethanone |
| SMILES | O=C(COCC(F)(F)F)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C14H10ClF3O2/c15-12-6-5-11(9-3-1-2-4-10(9)12)13(19)7-20-8-14(16,17)18/h1-6H,7-8H2 |
| InChIKey | NINKILJEHVJBLE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.68 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |