C16H15ClO3 — CID 79597299
4-(4-chloronaphthalen-1-yl)-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 79597299) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is 4-(4-chloronaphthalen-1-yl)-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(4-chloronaphthalen-1-yl)-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 79597299 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-(4-chloronaphthalen-1-yl)-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C)(CC(=O)c1ccc(Cl)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H15ClO3/c1-16(2,15(19)20)9-14(18)12-7-8-13(17)11-6-4-3-5-10(11)12/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | OUCFORLGJMJVTB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |