C19H19ClO — CID 79591378
2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloronaphthalen-1-yl)ethanone (PubChem CID 79591378) has the molecular formula C19H19ClO and a molecular weight of 298.81 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloronaphthalen-1-yl)ethanone.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloronaphthalen-1-yl)ethanone |
|---|---|
| PubChem CID | 79591378 |
| Molecular Formula | C19H19ClO |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(4-chloronaphthalen-1-yl)ethanone |
| SMILES | O=C(CC1CC2CCC1C2)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C19H19ClO/c20-18-8-7-17(15-3-1-2-4-16(15)18)19(21)11-14-10-12-5-6-13(14)9-12/h1-4,7-8,12-14H,5-6,9-11H2 |
| InChIKey | RNFIVLAUCZBNQQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |