C19H19ClO2 — CID 18556909
(4-chloronaphthalen-1-yl) 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 18556909) has the molecular formula C19H19ClO2 and a molecular weight of 314.81 g/mol. Its IUPAC name is (4-chloronaphthalen-1-yl) 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | (4-chloronaphthalen-1-yl) 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 18556909 |
| Molecular Formula | C19H19ClO2 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (4-chloronaphthalen-1-yl) 2-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | O=C(C[C@@H]1C[C@@H]2CC[C@@H]1C2)Oc1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C19H19ClO2/c20-17-7-8-18(16-4-2-1-3-15(16)17)22-19(21)11-14-10-12-5-6-13(14)9-12/h1-4,7-8,12-14H,5-6,9-11H2/t12-,13-,14+/m1/s1 |
| InChIKey | GHTPAAQQGIQXNH-MCIONIFRSA-N |
| XLogP | 5.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|