C16H19FO — CID 115784981
2-(2-bicyclo[2.2.1]heptanyl)-1-(2-fluoro-4-methylphenyl)ethanone (PubChem CID 115784981) has the molecular formula C16H19FO and a molecular weight of 246.32 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-(2-fluoro-4-methylphenyl)ethanone.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(2-fluoro-4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 115784981 |
| Molecular Formula | C16H19FO |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-(2-fluoro-4-methylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)CC2CC3CCC2C3)c(F)c1 |
| InChI | InChI=1S/C16H19FO/c1-10-2-5-14(15(17)6-10)16(18)9-13-8-11-3-4-12(13)7-11/h2,5-6,11-13H,3-4,7-9H2,1H3 |
| InChIKey | IAJQQIUJQHCKJV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |