C16H20FNO2 — CID 144525769
2-(1-acetylpiperidin-4-yl)-1-(2-fluoro-4-methylphenyl)ethanone (PubChem CID 144525769) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-(1-acetylpiperidin-4-yl)-1-(2-fluoro-4-methylphenyl)ethanone.
| Compound Name | 2-(1-acetylpiperidin-4-yl)-1-(2-fluoro-4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 144525769 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-(1-acetylpiperidin-4-yl)-1-(2-fluoro-4-methylphenyl)ethanone |
| SMILES | CC(=O)N1CCC(CC(=O)c2ccc(C)cc2F)CC1 |
| InChI | InChI=1S/C16H20FNO2/c1-11-3-4-14(15(17)9-11)16(20)10-13-5-7-18(8-6-13)12(2)19/h3-4,9,13H,5-8,10H2,1-2H3 |
| InChIKey | JEOKAQCIKCWEII-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |