C17H21BrFNO3 — CID 159472605
tert-butyl (3S)-3-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl]pyrrolidine-1-carboxylate (PubChem CID 159472605) has the molecular formula C17H21BrFNO3 and a molecular weight of 386.26 g/mol. Its IUPAC name is tert-butyl (3S)-3-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 159472605 |
| Molecular Formula | C17H21BrFNO3 |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | tert-butyl (3S)-3-[2-(4-bromo-2-fluorophenyl)-2-oxoethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](CC(=O)c2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C17H21BrFNO3/c1-17(2,3)23-16(22)20-7-6-11(10-20)8-15(21)13-5-4-12(18)9-14(13)19/h4-5,9,11H,6-8,10H2,1-3H3/t11-/m0/s1 |
| InChIKey | DQPABEXEFYRAKD-NSHDSACASA-N |
| XLogP | 4.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |