C12H7ClF2O — CID 103513654
1-(4-chloronaphthalen-1-yl)-2,2-difluoroethanone (PubChem CID 103513654) has the molecular formula C12H7ClF2O and a molecular weight of 240.64 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)-2,2-difluoroethanone.
| Compound Name | 1-(4-chloronaphthalen-1-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 103513654 |
| Molecular Formula | C12H7ClF2O |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)-2,2-difluoroethanone |
| SMILES | O=C(c1ccc(Cl)c2ccccc12)C(F)F |
| InChI | InChI=1S/C12H7ClF2O/c13-10-6-5-9(11(16)12(14)15)7-3-1-2-4-8(7)10/h1-6,12H |
| InChIKey | ZGRZUQKQWDONCM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |