C15H15ClO — CID 79601820
1-(4-chloronaphthalen-1-yl)-2,2-dimethylpropan-1-one (PubChem CID 79601820) has the molecular formula C15H15ClO and a molecular weight of 246.74 g/mol. Its IUPAC name is 1-(4-chloronaphthalen-1-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(4-chloronaphthalen-1-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 79601820 |
| Molecular Formula | C15H15ClO |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-(4-chloronaphthalen-1-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C15H15ClO/c1-15(2,3)14(17)12-8-9-13(16)11-7-5-4-6-10(11)12/h4-9H,1-3H3 |
| InChIKey | WZOLDGLJDJLECA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |