C12H9F3O3 — CID 43799431
1-(1-benzofuran-3-yl)-2-(2,2,2-trifluoroethoxy)ethanone (PubChem CID 43799431) has the molecular formula C12H9F3O3 and a molecular weight of 258.19 g/mol. Its IUPAC name is 1-(1-benzofuran-3-yl)-2-(2,2,2-trifluoroethoxy)ethanone.
| Compound Name | 1-(1-benzofuran-3-yl)-2-(2,2,2-trifluoroethoxy)ethanone |
|---|---|
| PubChem CID | 43799431 |
| Molecular Formula | C12H9F3O3 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1-(1-benzofuran-3-yl)-2-(2,2,2-trifluoroethoxy)ethanone |
| SMILES | O=C(COCC(F)(F)F)c1coc2ccccc12 |
| InChI | InChI=1S/C12H9F3O3/c13-12(14,15)7-17-6-10(16)9-5-18-11-4-2-1-3-8(9)11/h1-5H,6-7H2 |
| InChIKey | UWASNXYTMQEVSD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |