C13H12F3NO3 — CID 103206823
1-(4-methoxy-1H-indol-3-yl)-2-(2,2,2-trifluoroethoxy)ethanone (PubChem CID 103206823) has the molecular formula C13H12F3NO3 and a molecular weight of 287.24 g/mol. Its IUPAC name is 1-(4-methoxy-1H-indol-3-yl)-2-(2,2,2-trifluoroethoxy)ethanone.
| Compound Name | 1-(4-methoxy-1H-indol-3-yl)-2-(2,2,2-trifluoroethoxy)ethanone |
|---|---|
| PubChem CID | 103206823 |
| Molecular Formula | C13H12F3NO3 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-(4-methoxy-1H-indol-3-yl)-2-(2,2,2-trifluoroethoxy)ethanone |
| SMILES | COc1cccc2[nH]cc(C(=O)COCC(F)(F)F)c12 |
| InChI | InChI=1S/C13H12F3NO3/c1-19-11-4-2-3-9-12(11)8(5-17-9)10(18)6-20-7-13(14,15)16/h2-5,17H,6-7H2,1H3 |
| InChIKey | XVEVOXXPVOKMGX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |