C16H11F2NO2 — CID 83164240
(3,5-difluorophenyl)-(4-methoxy-1H-indol-3-yl)methanone (PubChem CID 83164240) has the molecular formula C16H11F2NO2 and a molecular weight of 287.27 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(4-methoxy-1H-indol-3-yl)methanone.
| Compound Name | (3,5-difluorophenyl)-(4-methoxy-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 83164240 |
| Molecular Formula | C16H11F2NO2 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (3,5-difluorophenyl)-(4-methoxy-1H-indol-3-yl)methanone |
| SMILES | COc1cccc2[nH]cc(C(=O)c3cc(F)cc(F)c3)c12 |
| InChI | InChI=1S/C16H11F2NO2/c1-21-14-4-2-3-13-15(14)12(8-19-13)16(20)9-5-10(17)7-11(18)6-9/h2-8,19H,1H3 |
| InChIKey | DIAOIXHYYBLABI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |