C20H16ClNO4 — CID 3850963
dimethyl 2-(4-chlorophenyl)-1-phenylpyrrole-3,4-dicarboxylate (PubChem CID 3850963) has the molecular formula C20H16ClNO4 and a molecular weight of 369.80 g/mol. Its IUPAC name is dimethyl 2-(4-chlorophenyl)-1-phenylpyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(4-chlorophenyl)-1-phenylpyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 3850963 |
| Molecular Formula | C20H16ClNO4 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | dimethyl 2-(4-chlorophenyl)-1-phenylpyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)c1cn(-c2ccccc2)c(-c2ccc(Cl)cc2)c1C(=O)OC |
| InChI | InChI=1S/C20H16ClNO4/c1-25-19(23)16-12-22(15-6-4-3-5-7-15)18(17(16)20(24)26-2)13-8-10-14(21)11-9-13/h3-12H,1-2H3 |
| InChIKey | YNQUNXSCEWTLMC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |