C20H17Cl2NO4S — CID 91872837
chlorosulfonyl 5-(4-chlorophenyl)-4-ethyl-2-methyl-1-phenylpyrrole-3-carboxylate (PubChem CID 91872837) has the molecular formula C20H17Cl2NO4S and a molecular weight of 438.33 g/mol. Its IUPAC name is chlorosulfonyl 5-(4-chlorophenyl)-4-ethyl-2-methyl-1-phenylpyrrole-3-carboxylate.
| Compound Name | chlorosulfonyl 5-(4-chlorophenyl)-4-ethyl-2-methyl-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 91872837 |
| Molecular Formula | C20H17Cl2NO4S |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | chlorosulfonyl 5-(4-chlorophenyl)-4-ethyl-2-methyl-1-phenylpyrrole-3-carboxylate |
| SMILES | CCc1c(C(=O)OS(=O)(=O)Cl)c(C)n(-c2ccccc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17Cl2NO4S/c1-3-17-18(20(24)27-28(22,25)26)13(2)23(16-7-5-4-6-8-16)19(17)14-9-11-15(21)12-10-14/h4-12H,3H2,1-2H3 |
| InChIKey | NMNWOZOWNXWPIW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |