C23H22BrNO4 — CID 11525344
diethyl 1-(4-bromophenyl)-2-methyl-5-phenylpyrrole-3,4-dicarboxylate (PubChem CID 11525344) has the molecular formula C23H22BrNO4 and a molecular weight of 456.34 g/mol. Its IUPAC name is diethyl 1-(4-bromophenyl)-2-methyl-5-phenylpyrrole-3,4-dicarboxylate.
| Compound Name | diethyl 1-(4-bromophenyl)-2-methyl-5-phenylpyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11525344 |
| Molecular Formula | C23H22BrNO4 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | diethyl 1-(4-bromophenyl)-2-methyl-5-phenylpyrrole-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c(-c2ccccc2)n(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C23H22BrNO4/c1-4-28-22(26)19-15(3)25(18-13-11-17(24)12-14-18)21(16-9-7-6-8-10-16)20(19)23(27)29-5-2/h6-14H,4-5H2,1-3H3 |
| InChIKey | IUGYGLRAWADVSE-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |