C26H21NO3 — CID 102185335
ethyl 5-formyl-1,2,4-triphenylpyrrole-3-carboxylate (PubChem CID 102185335) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 5-formyl-1,2,4-triphenylpyrrole-3-carboxylate.
| Compound Name | ethyl 5-formyl-1,2,4-triphenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102185335 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 5-formyl-1,2,4-triphenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c(C=O)n(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H21NO3/c1-2-30-26(29)24-23(19-12-6-3-7-13-19)22(18-28)27(21-16-10-5-11-17-21)25(24)20-14-8-4-9-15-20/h3-18H,2H2,1H3 |
| InChIKey | RZUQFVUFAJCOJP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|