C28H31NO6 — CID 101336364
diethyl 1-(4-ethoxycarbonylphenyl)-2-phenyl-5-propylpyrrole-3,4-dicarboxylate (PubChem CID 101336364) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is diethyl 1-(4-ethoxycarbonylphenyl)-2-phenyl-5-propylpyrrole-3,4-dicarboxylate.
| Compound Name | diethyl 1-(4-ethoxycarbonylphenyl)-2-phenyl-5-propylpyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101336364 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | diethyl 1-(4-ethoxycarbonylphenyl)-2-phenyl-5-propylpyrrole-3,4-dicarboxylate |
| SMILES | CCCc1c(C(=O)OCC)c(C(=O)OCC)c(-c2ccccc2)n1-c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C28H31NO6/c1-5-12-22-23(27(31)34-7-3)24(28(32)35-8-4)25(19-13-10-9-11-14-19)29(22)21-17-15-20(16-18-21)26(30)33-6-2/h9-11,13-18H,5-8,12H2,1-4H3 |
| InChIKey | KJKGRZKWAKWJJL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|