C27H23NO6 — CID 90822104
ethyl 4-[2,3-dihydroxy-4-(2-methoxybenzoyl)-5-phenylpyrrol-1-yl]benzoate (PubChem CID 90822104) has the molecular formula C27H23NO6 and a molecular weight of 457.48 g/mol. Its IUPAC name is ethyl 4-[2,3-dihydroxy-4-(2-methoxybenzoyl)-5-phenylpyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[2,3-dihydroxy-4-(2-methoxybenzoyl)-5-phenylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 90822104 |
| Molecular Formula | C27H23NO6 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | ethyl 4-[2,3-dihydroxy-4-(2-methoxybenzoyl)-5-phenylpyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(O)c(O)c(C(=O)c3ccccc3OC)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23NO6/c1-3-34-27(32)18-13-15-19(16-14-18)28-23(17-9-5-4-6-10-17)22(25(30)26(28)31)24(29)20-11-7-8-12-21(20)33-2/h4-16,30-31H,3H2,1-2H3 |
| InChIKey | LHTMGMANMIHTLP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |