C26H20ClNO5 — CID 90839503
ethyl 4-[3-benzoyl-2-(4-chlorophenyl)-4,5-dihydroxypyrrol-1-yl]benzoate (PubChem CID 90839503) has the molecular formula C26H20ClNO5 and a molecular weight of 461.90 g/mol. Its IUPAC name is ethyl 4-[3-benzoyl-2-(4-chlorophenyl)-4,5-dihydroxypyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[3-benzoyl-2-(4-chlorophenyl)-4,5-dihydroxypyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 90839503 |
| Molecular Formula | C26H20ClNO5 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | ethyl 4-[3-benzoyl-2-(4-chlorophenyl)-4,5-dihydroxypyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(O)c(O)c(C(=O)c3ccccc3)c2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H20ClNO5/c1-2-33-26(32)18-10-14-20(15-11-18)28-22(16-8-12-19(27)13-9-16)21(24(30)25(28)31)23(29)17-6-4-3-5-7-17/h3-15,30-31H,2H2,1H3 |
| InChIKey | FGXSUHQPJUVPGI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |