C22H20ClNO5 — CID 23650324
2-(4-chlorophenyl)-4-ethoxycarbonyl-1-(4-methoxyphenyl)-5-methylpyrrole-3-carboxylic acid (PubChem CID 23650324) has the molecular formula C22H20ClNO5 and a molecular weight of 413.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-ethoxycarbonyl-1-(4-methoxyphenyl)-5-methylpyrrole-3-carboxylic acid.
| Compound Name | 2-(4-chlorophenyl)-4-ethoxycarbonyl-1-(4-methoxyphenyl)-5-methylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 23650324 |
| Molecular Formula | C22H20ClNO5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-(4-chlorophenyl)-4-ethoxycarbonyl-1-(4-methoxyphenyl)-5-methylpyrrole-3-carboxylic acid |
| SMILES | CCOC(=O)c1c(C(=O)O)c(-c2ccc(Cl)cc2)n(-c2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C22H20ClNO5/c1-4-29-22(27)18-13(2)24(16-9-11-17(28-3)12-10-16)20(19(18)21(25)26)14-5-7-15(23)8-6-14/h5-12H,4H2,1-3H3,(H,25,26) |
| InChIKey | AYYMHUJUKSQRDR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |