C21H17Cl2NO3 — CID 22159888
ethyl 2,6-bis(4-chlorophenyl)-1-methyl-4-oxopyridine-3-carboxylate (PubChem CID 22159888) has the molecular formula C21H17Cl2NO3 and a molecular weight of 402.28 g/mol. Its IUPAC name is ethyl 2,6-bis(4-chlorophenyl)-1-methyl-4-oxopyridine-3-carboxylate.
| Compound Name | ethyl 2,6-bis(4-chlorophenyl)-1-methyl-4-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 22159888 |
| Molecular Formula | C21H17Cl2NO3 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | ethyl 2,6-bis(4-chlorophenyl)-1-methyl-4-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)n(C)c(-c2ccc(Cl)cc2)cc1=O |
| InChI | InChI=1S/C21H17Cl2NO3/c1-3-27-21(26)19-18(25)12-17(13-4-8-15(22)9-5-13)24(2)20(19)14-6-10-16(23)11-7-14/h4-12H,3H2,1-2H3 |
| InChIKey | FNYTWORTLBNGON-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |