C16H14Cl2INO3 — CID 170604899
ethyl 2-(3,4-dichlorophenyl)-1-ethyl-6-iodo-4-oxopyridine-3-carboxylate (PubChem CID 170604899) has the molecular formula C16H14Cl2INO3 and a molecular weight of 466.10 g/mol. Its IUPAC name is ethyl 2-(3,4-dichlorophenyl)-1-ethyl-6-iodo-4-oxopyridine-3-carboxylate.
| Compound Name | ethyl 2-(3,4-dichlorophenyl)-1-ethyl-6-iodo-4-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 170604899 |
| Molecular Formula | C16H14Cl2INO3 |
| Molecular Weight | 466.10 g/mol |
| Exact Mass | 464.94 |
| IUPAC Name | ethyl 2-(3,4-dichlorophenyl)-1-ethyl-6-iodo-4-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)n(CC)c(I)cc1=O |
| InChI | InChI=1S/C16H14Cl2INO3/c1-3-20-13(19)8-12(21)14(16(22)23-4-2)15(20)9-5-6-10(17)11(18)7-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | XGVWVAZKKPWRGX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.10 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|