C20H18Cl2N4O5 — CID 168932844
ethyl 2-(3,4-dichlorophenyl)-1-ethyl-6-[(5-nitroimidazol-1-yl)methyl]-4-oxopyridine-3-carboxylate (PubChem CID 168932844) has the molecular formula C20H18Cl2N4O5 and a molecular weight of 465.29 g/mol. Its IUPAC name is ethyl 2-(3,4-dichlorophenyl)-1-ethyl-6-[(5-nitroimidazol-1-yl)methyl]-4-oxopyridine-3-carboxylate.
| Compound Name | ethyl 2-(3,4-dichlorophenyl)-1-ethyl-6-[(5-nitroimidazol-1-yl)methyl]-4-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 168932844 |
| Molecular Formula | C20H18Cl2N4O5 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | ethyl 2-(3,4-dichlorophenyl)-1-ethyl-6-[(5-nitroimidazol-1-yl)methyl]-4-oxopyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)n(CC)c(Cn2cncc2[N+](=O)[O-])cc1=O |
| InChI | InChI=1S/C20H18Cl2N4O5/c1-3-25-13(10-24-11-23-9-17(24)26(29)30)8-16(27)18(20(28)31-4-2)19(25)12-5-6-14(21)15(22)7-12/h5-9,11H,3-4,10H2,1-2H3 |
| InChIKey | ZXCOFMFBVWOOBC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 109.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|