C20H19NO2 — CID 10852115
ethyl 1-methyl-2,4-diphenylpyrrole-3-carboxylate (PubChem CID 10852115) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is ethyl 1-methyl-2,4-diphenylpyrrole-3-carboxylate.
| Compound Name | ethyl 1-methyl-2,4-diphenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 10852115 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | ethyl 1-methyl-2,4-diphenylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)cn(C)c1-c1ccccc1 |
| InChI | InChI=1S/C20H19NO2/c1-3-23-20(22)18-17(15-10-6-4-7-11-15)14-21(2)19(18)16-12-8-5-9-13-16/h4-14H,3H2,1-2H3 |
| InChIKey | UCFJROHXZJUCQW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |