C19H25NO2 — CID 102196273
ethyl 1-butyl-2,4-dimethyl-5-phenylpyrrole-3-carboxylate (PubChem CID 102196273) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is ethyl 1-butyl-2,4-dimethyl-5-phenylpyrrole-3-carboxylate.
| Compound Name | ethyl 1-butyl-2,4-dimethyl-5-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 102196273 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | ethyl 1-butyl-2,4-dimethyl-5-phenylpyrrole-3-carboxylate |
| SMILES | CCCCn1c(C)c(C(=O)OCC)c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C19H25NO2/c1-5-7-13-20-15(4)17(19(21)22-6-2)14(3)18(20)16-11-9-8-10-12-16/h8-12H,5-7,13H2,1-4H3 |
| InChIKey | ZDKGGOGNNOUAFM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |