C18H21NO4 — CID 66570713
diethyl 1,5-dimethyl-3-phenylpyrrole-2,4-dicarboxylate (PubChem CID 66570713) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is diethyl 1,5-dimethyl-3-phenylpyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 1,5-dimethyl-3-phenylpyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 66570713 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | diethyl 1,5-dimethyl-3-phenylpyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c(C(=O)OCC)n(C)c1C |
| InChI | InChI=1S/C18H21NO4/c1-5-22-17(20)14-12(3)19(4)16(18(21)23-6-2)15(14)13-10-8-7-9-11-13/h7-11H,5-6H2,1-4H3 |
| InChIKey | JMOUFFUEOMOHGD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |