C32H23NO3 — CID 132596240
ethyl 3-benzoyl-2-phenylnaphtho[2,1-e]indolizine-1-carboxylate (PubChem CID 132596240) has the molecular formula C32H23NO3 and a molecular weight of 469.54 g/mol. Its IUPAC name is ethyl 3-benzoyl-2-phenylnaphtho[2,1-e]indolizine-1-carboxylate.
| Compound Name | ethyl 3-benzoyl-2-phenylnaphtho[2,1-e]indolizine-1-carboxylate |
|---|---|
| PubChem CID | 132596240 |
| Molecular Formula | C32H23NO3 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | ethyl 3-benzoyl-2-phenylnaphtho[2,1-e]indolizine-1-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c(C(=O)c2ccccc2)n2c1ccc1c3ccccc3ccc12 |
| InChI | InChI=1S/C32H23NO3/c1-2-36-32(35)29-27-20-18-25-24-16-10-9-11-21(24)17-19-26(25)33(27)30(28(29)22-12-5-3-6-13-22)31(34)23-14-7-4-8-15-23/h3-20H,2H2,1H3 |
| InChIKey | ZFIMNCJJPLWTHN-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|