C33H26N2O3 — CID 56931222
ethyl 1-benzoyl-4-benzyl-3-phenylpyrrolo[1,2-a]benzimidazole-2-carboxylate (PubChem CID 56931222) has the molecular formula C33H26N2O3 and a molecular weight of 498.58 g/mol. Its IUPAC name is ethyl 1-benzoyl-4-benzyl-3-phenylpyrrolo[1,2-a]benzimidazole-2-carboxylate.
| Compound Name | ethyl 1-benzoyl-4-benzyl-3-phenylpyrrolo[1,2-a]benzimidazole-2-carboxylate |
|---|---|
| PubChem CID | 56931222 |
| Molecular Formula | C33H26N2O3 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | ethyl 1-benzoyl-4-benzyl-3-phenylpyrrolo[1,2-a]benzimidazole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c2n(Cc3ccccc3)c3ccccc3n2c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C33H26N2O3/c1-2-38-33(37)29-28(24-16-8-4-9-17-24)32-34(22-23-14-6-3-7-15-23)26-20-12-13-21-27(26)35(32)30(29)31(36)25-18-10-5-11-19-25/h3-21H,2,22H2,1H3 |
| InChIKey | FNTHYCBGJHEAPD-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |