C33H27N3O4 — CID 56931475
ethyl 4-benzyl-3-(4-methylphenyl)-1-(4-nitrophenyl)pyrrolo[1,2-a]benzimidazole-2-carboxylate (PubChem CID 56931475) has the molecular formula C33H27N3O4 and a molecular weight of 529.60 g/mol. Its IUPAC name is ethyl 4-benzyl-3-(4-methylphenyl)-1-(4-nitrophenyl)pyrrolo[1,2-a]benzimidazole-2-carboxylate.
| Compound Name | ethyl 4-benzyl-3-(4-methylphenyl)-1-(4-nitrophenyl)pyrrolo[1,2-a]benzimidazole-2-carboxylate |
|---|---|
| PubChem CID | 56931475 |
| Molecular Formula | C33H27N3O4 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | ethyl 4-benzyl-3-(4-methylphenyl)-1-(4-nitrophenyl)pyrrolo[1,2-a]benzimidazole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)c2n(Cc3ccccc3)c3ccccc3n2c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H27N3O4/c1-3-40-33(37)30-29(24-15-13-22(2)14-16-24)32-34(21-23-9-5-4-6-10-23)27-11-7-8-12-28(27)35(32)31(30)25-17-19-26(20-18-25)36(38)39/h4-20H,3,21H2,1-2H3 |
| InChIKey | RQXRPPRBOAVXIS-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 78.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|