C21H20N2O6S — CID 57390870
ethyl 1-(benzenesulfonyl)-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylate (PubChem CID 57390870) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is ethyl 1-(benzenesulfonyl)-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylate.
| Compound Name | ethyl 1-(benzenesulfonyl)-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 57390870 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | ethyl 1-(benzenesulfonyl)-2,5-dimethyl-4-(4-nitrophenyl)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc([N+](=O)[O-])cc2)c(C)n(S(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C21H20N2O6S/c1-4-29-21(24)20-15(3)22(30(27,28)18-8-6-5-7-9-18)14(2)19(20)16-10-12-17(13-11-16)23(25)26/h5-13H,4H2,1-3H3 |
| InChIKey | HGLOBLYGOSCYIW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 108.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|