C23H19BrN2O6 — CID 4738285
5-O-ethyl 3-O-methyl 2-(bromomethyl)-4-(4-nitrophenyl)-6-phenylpyridine-3,5-dicarboxylate (PubChem CID 4738285) has the molecular formula C23H19BrN2O6 and a molecular weight of 499.32 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 2-(bromomethyl)-4-(4-nitrophenyl)-6-phenylpyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 2-(bromomethyl)-4-(4-nitrophenyl)-6-phenylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 4738285 |
| Molecular Formula | C23H19BrN2O6 |
| Molecular Weight | 499.32 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2-(bromomethyl)-4-(4-nitrophenyl)-6-phenylpyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)nc(CBr)c(C(=O)OC)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19BrN2O6/c1-3-32-23(28)20-18(14-9-11-16(12-10-14)26(29)30)19(22(27)31-2)17(13-24)25-21(20)15-7-5-4-6-8-15/h4-12H,3,13H2,1-2H3 |
| InChIKey | OBWVQSOJVYEIDN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|