C17H16N2O8 — CID 164677009
2-O,3-O-diethyl 4-O-methyl 6-nitroquinoline-2,3,4-tricarboxylate (PubChem CID 164677009) has the molecular formula C17H16N2O8 and a molecular weight of 376.32 g/mol. Its IUPAC name is 2-O,3-O-diethyl 4-O-methyl 6-nitroquinoline-2,3,4-tricarboxylate.
| Compound Name | 2-O,3-O-diethyl 4-O-methyl 6-nitroquinoline-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 164677009 |
| Molecular Formula | C17H16N2O8 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-O,3-O-diethyl 4-O-methyl 6-nitroquinoline-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)c1nc2ccc([N+](=O)[O-])cc2c(C(=O)OC)c1C(=O)OCC |
| InChI | InChI=1S/C17H16N2O8/c1-4-26-16(21)13-12(15(20)25-3)10-8-9(19(23)24)6-7-11(10)18-14(13)17(22)27-5-2/h6-8H,4-5H2,1-3H3 |
| InChIKey | PQRCXLBCEWNWRO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 134.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|