C15H17N3O4 — CID 3783543
ethyl 6-nitro-4-(propan-2-ylamino)quinoline-3-carboxylate (PubChem CID 3783543) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is ethyl 6-nitro-4-(propan-2-ylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 6-nitro-4-(propan-2-ylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 3783543 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | ethyl 6-nitro-4-(propan-2-ylamino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc([N+](=O)[O-])cc2c1NC(C)C |
| InChI | InChI=1S/C15H17N3O4/c1-4-22-15(19)12-8-16-13-6-5-10(18(20)21)7-11(13)14(12)17-9(2)3/h5-9H,4H2,1-3H3,(H,16,17) |
| InChIKey | OYPPWIOVFFZMLE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|