C19H16BrN3O4 — CID 155367892
ethyl 6-bromo-4-(2-methyl-5-nitroanilino)quinoline-3-carboxylate (PubChem CID 155367892) has the molecular formula C19H16BrN3O4 and a molecular weight of 430.26 g/mol. Its IUPAC name is ethyl 6-bromo-4-(2-methyl-5-nitroanilino)quinoline-3-carboxylate.
| Compound Name | ethyl 6-bromo-4-(2-methyl-5-nitroanilino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 155367892 |
| Molecular Formula | C19H16BrN3O4 |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | ethyl 6-bromo-4-(2-methyl-5-nitroanilino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(Br)cc2c1Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C19H16BrN3O4/c1-3-27-19(24)15-10-21-16-7-5-12(20)8-14(16)18(15)22-17-9-13(23(25)26)6-4-11(17)2/h4-10H,3H2,1-2H3,(H,21,22) |
| InChIKey | FNVNEQXNFJYWKF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|