C16H17BrN2O3 — CID 118503001
ethyl 6-bromo-4-[(3-hydroxycyclobutyl)amino]quinoline-3-carboxylate (PubChem CID 118503001) has the molecular formula C16H17BrN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is ethyl 6-bromo-4-[(3-hydroxycyclobutyl)amino]quinoline-3-carboxylate.
| Compound Name | ethyl 6-bromo-4-[(3-hydroxycyclobutyl)amino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 118503001 |
| Molecular Formula | C16H17BrN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | ethyl 6-bromo-4-[(3-hydroxycyclobutyl)amino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(Br)cc2c1NC1CC(O)C1 |
| InChI | InChI=1S/C16H17BrN2O3/c1-2-22-16(21)13-8-18-14-4-3-9(17)5-12(14)15(13)19-10-6-11(20)7-10/h3-5,8,10-11,20H,2,6-7H2,1H3,(H,18,19) |
| InChIKey | RXFPKVDEIDZPJR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |