C15H15N3O4 — CID 3319460
ethyl 6-nitro-4-(prop-2-enylamino)quinoline-3-carboxylate (PubChem CID 3319460) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is ethyl 6-nitro-4-(prop-2-enylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 6-nitro-4-(prop-2-enylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 3319460 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | ethyl 6-nitro-4-(prop-2-enylamino)quinoline-3-carboxylate |
| SMILES | C=CCNc1c(C(=O)OCC)cnc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C15H15N3O4/c1-3-7-16-14-11-8-10(18(20)21)5-6-13(11)17-9-12(14)15(19)22-4-2/h3,5-6,8-9H,1,4,7H2,2H3,(H,16,17) |
| InChIKey | VWIRFLPRDUWZTJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|