C15H16N2O2 — CID 13295816
ethyl 4-(prop-2-enylamino)quinoline-3-carboxylate (PubChem CID 13295816) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is ethyl 4-(prop-2-enylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 4-(prop-2-enylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 13295816 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | ethyl 4-(prop-2-enylamino)quinoline-3-carboxylate |
| SMILES | C=CCNc1c(C(=O)OCC)cnc2ccccc12 |
| InChI | InChI=1S/C15H16N2O2/c1-3-9-16-14-11-7-5-6-8-13(11)17-10-12(14)15(18)19-4-2/h3,5-8,10H,1,4,9H2,2H3,(H,16,17) |
| InChIKey | PQZVCTJKRALTHL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|