C14H13F3N2O2 — CID 133368454
ethyl 4-(2,2-difluoroethylamino)-6-fluoroquinoline-3-carboxylate (PubChem CID 133368454) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is ethyl 4-(2,2-difluoroethylamino)-6-fluoroquinoline-3-carboxylate.
| Compound Name | ethyl 4-(2,2-difluoroethylamino)-6-fluoroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 133368454 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | ethyl 4-(2,2-difluoroethylamino)-6-fluoroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(F)cc2c1NCC(F)F |
| InChI | InChI=1S/C14H13F3N2O2/c1-2-21-14(20)10-6-18-11-4-3-8(15)5-9(11)13(10)19-7-12(16)17/h3-6,12H,2,7H2,1H3,(H,18,19) |
| InChIKey | IPJUDRGBDREZGC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |