C19H25N3O4 — CID 1078338
diethyl 4-[2-(dimethylamino)ethylamino]quinoline-3,6-dicarboxylate (PubChem CID 1078338) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is diethyl 4-[2-(dimethylamino)ethylamino]quinoline-3,6-dicarboxylate.
| Compound Name | diethyl 4-[2-(dimethylamino)ethylamino]quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 1078338 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | diethyl 4-[2-(dimethylamino)ethylamino]quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2ncc(C(=O)OCC)c(NCCN(C)C)c2c1 |
| InChI | InChI=1S/C19H25N3O4/c1-5-25-18(23)13-7-8-16-14(11-13)17(20-9-10-22(3)4)15(12-21-16)19(24)26-6-2/h7-8,11-12H,5-6,9-10H2,1-4H3,(H,20,21) |
| InChIKey | RCEQZOJLFPGJIV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |