C17H20N2O4 — CID 43839933
diethyl 4-(dimethylamino)quinoline-3,7-dicarboxylate (PubChem CID 43839933) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is diethyl 4-(dimethylamino)quinoline-3,7-dicarboxylate.
| Compound Name | diethyl 4-(dimethylamino)quinoline-3,7-dicarboxylate |
|---|---|
| PubChem CID | 43839933 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | diethyl 4-(dimethylamino)quinoline-3,7-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2c(N(C)C)c(C(=O)OCC)cnc2c1 |
| InChI | InChI=1S/C17H20N2O4/c1-5-22-16(20)11-7-8-12-14(9-11)18-10-13(15(12)19(3)4)17(21)23-6-2/h7-10H,5-6H2,1-4H3 |
| InChIKey | RNRCABJQMJURTD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |