C12H11ClN2O2 — CID 609428
ethyl 4-amino-7-chloroquinoline-3-carboxylate (PubChem CID 609428) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is ethyl 4-amino-7-chloroquinoline-3-carboxylate.
| Compound Name | ethyl 4-amino-7-chloroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 609428 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | ethyl 4-amino-7-chloroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(Cl)ccc2c1N |
| InChI | InChI=1S/C12H11ClN2O2/c1-2-17-12(16)9-6-15-10-5-7(13)3-4-8(10)11(9)14/h3-6H,2H2,1H3,(H2,14,15) |
| InChIKey | GCUDZNYLJSRGCN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |