C15H16N2O4 — CID 17028175
diethyl 4-aminoquinoline-3,6-dicarboxylate (PubChem CID 17028175) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is diethyl 4-aminoquinoline-3,6-dicarboxylate.
| Compound Name | diethyl 4-aminoquinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 17028175 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | diethyl 4-aminoquinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2ncc(C(=O)OCC)c(N)c2c1 |
| InChI | InChI=1S/C15H16N2O4/c1-3-20-14(18)9-5-6-12-10(7-9)13(16)11(8-17-12)15(19)21-4-2/h5-8H,3-4H2,1-2H3,(H2,16,17) |
| InChIKey | OPSDJTRVRBVVNM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |