C24H26N2O5 — CID 23794912
diethyl 4-(4-propoxyanilino)quinoline-3,6-dicarboxylate (PubChem CID 23794912) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is diethyl 4-(4-propoxyanilino)quinoline-3,6-dicarboxylate.
| Compound Name | diethyl 4-(4-propoxyanilino)quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 23794912 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | diethyl 4-(4-propoxyanilino)quinoline-3,6-dicarboxylate |
| SMILES | CCCOc1ccc(Nc2c(C(=O)OCC)cnc3ccc(C(=O)OCC)cc23)cc1 |
| InChI | InChI=1S/C24H26N2O5/c1-4-13-31-18-10-8-17(9-11-18)26-22-19-14-16(23(27)29-5-2)7-12-21(19)25-15-20(22)24(28)30-6-3/h7-12,14-15H,4-6,13H2,1-3H3,(H,25,26) |
| InChIKey | IRERDPJZGTUYEC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |